C18H23N5O3S — CID 56503754
2-methyl-N-[4-[2-[2-[2-(4-methylanilino)acetyl]hydrazinyl]-2-oxoethyl]-1,3-thiazol-2-yl]propanamide (PubChem CID 56503754) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-methyl-N-[4-[2-[2-[2-(4-methylanilino)acetyl]hydrazinyl]-2-oxoethyl]-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-methyl-N-[4-[2-[2-[2-(4-methylanilino)acetyl]hydrazinyl]-2-oxoethyl]-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 56503754 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-methyl-N-[4-[2-[2-[2-(4-methylanilino)acetyl]hydrazinyl]-2-oxoethyl]-1,3-thiazol-2-yl]propanamide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)Cc2csc(NC(=O)C(C)C)n2)cc1 |
| InChI | InChI=1S/C18H23N5O3S/c1-11(2)17(26)21-18-20-14(10-27-18)8-15(24)22-23-16(25)9-19-13-6-4-12(3)5-7-13/h4-7,10-11,19H,8-9H2,1-3H3,(H,22,24)(H,23,25)(H,20,21,26) |
| InChIKey | HSZGTODYMMECOL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|