C16H15F4N3O3S — CID 9076206
(3R)-4,4,4-trifluoro-N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]-3-hydroxy-3-methylbutanehydrazide (PubChem CID 9076206) has the molecular formula C16H15F4N3O3S and a molecular weight of 405.37 g/mol. Its IUPAC name is (3R)-4,4,4-trifluoro-N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]-3-hydroxy-3-methylbutanehydrazide.
| Compound Name | (3R)-4,4,4-trifluoro-N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]-3-hydroxy-3-methylbutanehydrazide |
|---|---|
| PubChem CID | 9076206 |
| Molecular Formula | C16H15F4N3O3S |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | (3R)-4,4,4-trifluoro-N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]-3-hydroxy-3-methylbutanehydrazide |
| SMILES | C[C@@](O)(CC(=O)NNC(=O)Cc1csc(-c2ccc(F)cc2)n1)C(F)(F)F |
| InChI | InChI=1S/C16H15F4N3O3S/c1-15(26,16(18,19)20)7-13(25)23-22-12(24)6-11-8-27-14(21-11)9-2-4-10(17)5-3-9/h2-5,8,26H,6-7H2,1H3,(H,22,24)(H,23,25)/t15-/m1/s1 |
| InChIKey | OJSBLPZUJPKHKK-OAHLLOKOSA-N |
| XLogP | 2.34 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|