C22H22FN3O2S — CID 9076071
(2S)-N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]-2-phenylpentanehydrazide (PubChem CID 9076071) has the molecular formula C22H22FN3O2S and a molecular weight of 411.50 g/mol. Its IUPAC name is (2S)-N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]-2-phenylpentanehydrazide.
| Compound Name | (2S)-N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]-2-phenylpentanehydrazide |
|---|---|
| PubChem CID | 9076071 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | (2S)-N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]-2-phenylpentanehydrazide |
| SMILES | CCC[C@H](C(=O)NNC(=O)Cc1csc(-c2ccc(F)cc2)n1)c1ccccc1 |
| InChI | InChI=1S/C22H22FN3O2S/c1-2-6-19(15-7-4-3-5-8-15)21(28)26-25-20(27)13-18-14-29-22(24-18)16-9-11-17(23)12-10-16/h3-5,7-12,14,19H,2,6,13H2,1H3,(H,25,27)(H,26,28)/t19-/m0/s1 |
| InChIKey | UNDCGPOWVMQOGT-IBGZPJMESA-N |
| XLogP | 4.22 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|