C18H15N3O2S — CID 4800325
N'-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]benzohydrazide (PubChem CID 4800325) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is N'-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]benzohydrazide.
| Compound Name | N'-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 4800325 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N'-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]benzohydrazide |
| SMILES | O=C(Cc1csc(-c2ccccc2)n1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H15N3O2S/c22-16(20-21-17(23)13-7-3-1-4-8-13)11-15-12-24-18(19-15)14-9-5-2-6-10-14/h1-10,12H,11H2,(H,20,22)(H,21,23) |
| InChIKey | QRLXJPUASKONLU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|