C22H20FN3O2S — CID 9076127
N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]-5,6,7,8-tetrahydronaphthalene-2-carbohydrazide (PubChem CID 9076127) has the molecular formula C22H20FN3O2S and a molecular weight of 409.49 g/mol. Its IUPAC name is N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]-5,6,7,8-tetrahydronaphthalene-2-carbohydrazide.
| Compound Name | N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]-5,6,7,8-tetrahydronaphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 9076127 |
| Molecular Formula | C22H20FN3O2S |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]-5,6,7,8-tetrahydronaphthalene-2-carbohydrazide |
| SMILES | O=C(Cc1csc(-c2ccc(F)cc2)n1)NNC(=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H20FN3O2S/c23-18-9-7-15(8-10-18)22-24-19(13-29-22)12-20(27)25-26-21(28)17-6-5-14-3-1-2-4-16(14)11-17/h5-11,13H,1-4,12H2,(H,25,27)(H,26,28) |
| InChIKey | TUWRCPIQHGDZMQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|