C22H24FN3O2S3 — CID 42925083
N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]spiro[1,3-dithiolane-2,8'-bicyclo[3.2.1]octane]-3'-carbohydrazide (PubChem CID 42925083) has the molecular formula C22H24FN3O2S3 and a molecular weight of 477.65 g/mol. Its IUPAC name is N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]spiro[1,3-dithiolane-2,8'-bicyclo[3.2.1]octane]-3'-carbohydrazide.
| Compound Name | N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]spiro[1,3-dithiolane-2,8'-bicyclo[3.2.1]octane]-3'-carbohydrazide |
|---|---|
| PubChem CID | 42925083 |
| Molecular Formula | C22H24FN3O2S3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | N'-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]spiro[1,3-dithiolane-2,8'-bicyclo[3.2.1]octane]-3'-carbohydrazide |
| SMILES | O=C(Cc1csc(-c2ccc(F)cc2)n1)NNC(=O)C1CC2CCC(C1)C21SCCS1 |
| InChI | InChI=1S/C22H24FN3O2S3/c23-17-5-1-13(2-6-17)21-24-18(12-29-21)11-19(27)25-26-20(28)14-9-15-3-4-16(10-14)22(15)30-7-8-31-22/h1-2,5-6,12,14-16H,3-4,7-11H2,(H,25,27)(H,26,28) |
| InChIKey | YUHBKTLIDYUZTM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|