C20H18FN3OS — CID 8882089
2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(Z)-1-(4-methylphenyl)ethylideneamino]acetamide (PubChem CID 8882089) has the molecular formula C20H18FN3OS and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(Z)-1-(4-methylphenyl)ethylideneamino]acetamide.
| Compound Name | 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(Z)-1-(4-methylphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 8882089 |
| Molecular Formula | C20H18FN3OS |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(Z)-1-(4-methylphenyl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)Cc1csc(-c2ccc(F)cc2)n1)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H18FN3OS/c1-13-3-5-15(6-4-13)14(2)23-24-19(25)11-18-12-26-20(22-18)16-7-9-17(21)10-8-16/h3-10,12H,11H2,1-2H3,(H,24,25)/b23-14- |
| InChIKey | LFUMEIZYCDHZGR-UCQKPKSFSA-N |
| XLogP | 4.34 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|