C18H20FN3OS — CID 8882439
2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]acetamide (PubChem CID 8882439) has the molecular formula C18H20FN3OS and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]acetamide.
| Compound Name | 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]acetamide |
|---|---|
| PubChem CID | 8882439 |
| Molecular Formula | C18H20FN3OS |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]acetamide |
| SMILES | C[C@H]1CCCC/C1=N/NC(=O)Cc1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H20FN3OS/c1-12-4-2-3-5-16(12)21-22-17(23)10-15-11-24-18(20-15)13-6-8-14(19)9-7-13/h6-9,11-12H,2-5,10H2,1H3,(H,22,23)/b21-16-/t12-/m0/s1 |
| InChIKey | OSYFQFCLMCSHHM-SOFNNGJSSA-N |
| XLogP | 4.17 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|