C18H13F2N3OS — CID 8882365
N-[(Z)-(3-fluorophenyl)methylideneamino]-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 8882365) has the molecular formula C18H13F2N3OS and a molecular weight of 357.39 g/mol. Its IUPAC name is N-[(Z)-(3-fluorophenyl)methylideneamino]-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[(Z)-(3-fluorophenyl)methylideneamino]-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 8882365 |
| Molecular Formula | C18H13F2N3OS |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | N-[(Z)-(3-fluorophenyl)methylideneamino]-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C(Cc1csc(-c2ccc(F)cc2)n1)N/N=C\c1cccc(F)c1 |
| InChI | InChI=1S/C18H13F2N3OS/c19-14-6-4-13(5-7-14)18-22-16(11-25-18)9-17(24)23-21-10-12-2-1-3-15(20)8-12/h1-8,10-11H,9H2,(H,23,24)/b21-10- |
| InChIKey | FKGANYWWEQSOBJ-FBHDLOMBSA-N |
| XLogP | 3.78 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|