C19H15F2N3O2S — CID 8882743
N-[(Z)-(3-fluoro-4-methoxyphenyl)methylideneamino]-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 8882743) has the molecular formula C19H15F2N3O2S and a molecular weight of 387.41 g/mol. Its IUPAC name is N-[(Z)-(3-fluoro-4-methoxyphenyl)methylideneamino]-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[(Z)-(3-fluoro-4-methoxyphenyl)methylideneamino]-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 8882743 |
| Molecular Formula | C19H15F2N3O2S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-[(Z)-(3-fluoro-4-methoxyphenyl)methylideneamino]-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)Cc2csc(-c3ccc(F)cc3)n2)cc1F |
| InChI | InChI=1S/C19H15F2N3O2S/c1-26-17-7-2-12(8-16(17)21)10-22-24-18(25)9-15-11-27-19(23-15)13-3-5-14(20)6-4-13/h2-8,10-11H,9H2,1H3,(H,24,25)/b22-10- |
| InChIKey | VYHNSUQAFOSLFX-YVNNLAQVSA-N |
| XLogP | 3.79 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|