C21H15FN4O2S — CID 135689827
2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]acetamide (PubChem CID 135689827) has the molecular formula C21H15FN4O2S and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]acetamide.
| Compound Name | 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135689827 |
| Molecular Formula | C21H15FN4O2S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]acetamide |
| SMILES | O=C(Cc1csc(-c2ccc(F)cc2)n1)N/N=C/c1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C21H15FN4O2S/c22-16-7-5-13(6-8-16)21-24-17(12-29-21)10-19(27)26-23-11-15-9-14-3-1-2-4-18(14)25-20(15)28/h1-9,11-12H,10H2,(H,25,28)(H,26,27)/b23-11+ |
| InChIKey | LYPZMIJKOZAZFD-FOKLQQMPSA-N |
| XLogP | 3.48 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|