C21H18FN3O2S — CID 8882699
2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]acetamide (PubChem CID 8882699) has the molecular formula C21H18FN3O2S and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 8882699 |
| Molecular Formula | C21H18FN3O2S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]acetamide |
| SMILES | C=CCOc1cccc(/C=N\NC(=O)Cc2csc(-c3ccc(F)cc3)n2)c1 |
| InChI | InChI=1S/C21H18FN3O2S/c1-2-10-27-19-5-3-4-15(11-19)13-23-25-20(26)12-18-14-28-21(24-18)16-6-8-17(22)9-7-16/h2-9,11,13-14H,1,10,12H2,(H,25,26)/b23-13- |
| InChIKey | BLLBIHNADUEFLP-QRVIBDJDSA-N |
| XLogP | 4.21 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|