C29H20BrF3N4O2S2 — CID 51040617
N-[(E)-[3-[[2-(4-bromophenyl)-1,3-thiazol-4-yl]methoxy]phenyl]methylideneamino]-2-[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetamide (PubChem CID 51040617) has the molecular formula C29H20BrF3N4O2S2 and a molecular weight of 657.54 g/mol. Its IUPAC name is N-[(E)-[3-[[2-(4-bromophenyl)-1,3-thiazol-4-yl]methoxy]phenyl]methylideneamino]-2-[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[(E)-[3-[[2-(4-bromophenyl)-1,3-thiazol-4-yl]methoxy]phenyl]methylideneamino]-2-[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 51040617 |
| Molecular Formula | C29H20BrF3N4O2S2 |
| Molecular Weight | 657.54 g/mol |
| Exact Mass | 656.02 |
| IUPAC Name | N-[(E)-[3-[[2-(4-bromophenyl)-1,3-thiazol-4-yl]methoxy]phenyl]methylideneamino]-2-[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C(Cc1csc(-c2cccc(C(F)(F)F)c2)n1)N/N=C/c1cccc(OCc2csc(-c3ccc(Br)cc3)n2)c1 |
| InChI | InChI=1S/C29H20BrF3N4O2S2/c30-22-9-7-19(8-10-22)27-36-24(17-41-27)15-39-25-6-1-3-18(11-25)14-34-37-26(38)13-23-16-40-28(35-23)20-4-2-5-21(12-20)29(31,32)33/h1-12,14,16-17H,13,15H2,(H,37,38)/b34-14+ |
| InChIKey | QYEDMKLTTBOUHR-HBHSWBPBSA-N |
| XLogP | 7.99 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.54 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|