C22H18BrIN2O2 — CID 98050626
2-(4-bromophenyl)-N-[(Z)-[3-[(4-iodophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 98050626) has the molecular formula C22H18BrIN2O2 and a molecular weight of 549.21 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-[(Z)-[3-[(4-iodophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-bromophenyl)-N-[(Z)-[3-[(4-iodophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98050626 |
| Molecular Formula | C22H18BrIN2O2 |
| Molecular Weight | 549.21 g/mol |
| Exact Mass | 547.96 |
| IUPAC Name | 2-(4-bromophenyl)-N-[(Z)-[3-[(4-iodophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc(Br)cc1)N/N=C\c1cccc(OCc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C22H18BrIN2O2/c23-19-8-4-16(5-9-19)13-22(27)26-25-14-18-2-1-3-21(12-18)28-15-17-6-10-20(24)11-7-17/h1-12,14H,13,15H2,(H,26,27)/b25-14- |
| InChIKey | WFJJRFWLENKVAT-QFEZKATASA-N |
| XLogP | 5.33 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.21 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|