C22H19BrIN3O2 — CID 126048433
N-[(Z)-[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-(4-iodoanilino)acetamide (PubChem CID 126048433) has the molecular formula C22H19BrIN3O2 and a molecular weight of 564.22 g/mol. Its IUPAC name is N-[(Z)-[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-(4-iodoanilino)acetamide.
| Compound Name | N-[(Z)-[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-(4-iodoanilino)acetamide |
|---|---|
| PubChem CID | 126048433 |
| Molecular Formula | C22H19BrIN3O2 |
| Molecular Weight | 564.22 g/mol |
| Exact Mass | 562.97 |
| IUPAC Name | N-[(Z)-[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-(4-iodoanilino)acetamide |
| SMILES | O=C(CNc1ccc(I)cc1)N/N=C\c1ccc(OCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H19BrIN3O2/c23-18-5-1-17(2-6-18)15-29-21-11-3-16(4-12-21)13-26-27-22(28)14-25-20-9-7-19(24)8-10-20/h1-13,25H,14-15H2,(H,27,28)/b26-13- |
| InChIKey | LWEBRDQWRCFNNI-ZMFRSBBQSA-N |
| XLogP | 5.19 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.22 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|