C21H16BrIN2O2 — CID 98677523
4-[(4-bromophenyl)methoxy]-N-[(Z)-(4-iodophenyl)methylideneamino]benzamide (PubChem CID 98677523) has the molecular formula C21H16BrIN2O2 and a molecular weight of 535.18 g/mol. Its IUPAC name is 4-[(4-bromophenyl)methoxy]-N-[(Z)-(4-iodophenyl)methylideneamino]benzamide.
| Compound Name | 4-[(4-bromophenyl)methoxy]-N-[(Z)-(4-iodophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 98677523 |
| Molecular Formula | C21H16BrIN2O2 |
| Molecular Weight | 535.18 g/mol |
| Exact Mass | 533.94 |
| IUPAC Name | 4-[(4-bromophenyl)methoxy]-N-[(Z)-(4-iodophenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(I)cc1)c1ccc(OCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C21H16BrIN2O2/c22-18-7-1-16(2-8-18)14-27-20-11-5-17(6-12-20)21(26)25-24-13-15-3-9-19(23)10-4-15/h1-13H,14H2,(H,25,26)/b24-13- |
| InChIKey | YOAYASJCUNUEDQ-CFRMEGHHSA-N |
| XLogP | 5.40 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.18 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|