C23H19IN4O2 — CID 4561831
N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-(4-iodoanilino)acetamide (PubChem CID 4561831) has the molecular formula C23H19IN4O2 and a molecular weight of 510.34 g/mol. Its IUPAC name is N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-(4-iodoanilino)acetamide.
| Compound Name | N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-(4-iodoanilino)acetamide |
|---|---|
| PubChem CID | 4561831 |
| Molecular Formula | C23H19IN4O2 |
| Molecular Weight | 510.34 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-(4-iodoanilino)acetamide |
| SMILES | N#Cc1ccccc1COc1ccc(C=NNC(=O)CNc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C23H19IN4O2/c24-20-7-9-21(10-8-20)26-15-23(29)28-27-14-17-5-11-22(12-6-17)30-16-19-4-2-1-3-18(19)13-25/h1-12,14,26H,15-16H2,(H,28,29) |
| InChIKey | RBXWQPMERBCCIT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|