C24H17N3O3 — CID 1018695
N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 1018695) has the molecular formula C24H17N3O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 1018695 |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | N#Cc1ccccc1COc1ccc(C=NNC(=O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C24H17N3O3/c25-14-19-6-1-2-7-20(19)16-29-21-11-9-17(10-12-21)15-26-27-24(28)23-13-18-5-3-4-8-22(18)30-23/h1-13,15H,16H2,(H,27,28) |
| InChIKey | VGCGDSGYUUMQIE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|