C17H13FN4OS — CID 135731168
1-(4-fluorophenyl)-3-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]thiourea (PubChem CID 135731168) has the molecular formula C17H13FN4OS and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 135731168 |
| Molecular Formula | C17H13FN4OS |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]thiourea |
| SMILES | O=c1[nH]c2ccccc2cc1/C=N/NC(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H13FN4OS/c18-13-5-7-14(8-6-13)20-17(24)22-19-10-12-9-11-3-1-2-4-15(11)21-16(12)23/h1-10H,(H,21,23)(H2,20,22,24)/b19-10+ |
| InChIKey | KJQDNEAZKUKOQC-VXLYETTFSA-N |
| XLogP | 2.99 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|