C25H18BrN5O4 — CID 4595859
N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(2-oxo-1H-quinolin-3-yl)methylideneamino]oxamide (PubChem CID 4595859) has the molecular formula C25H18BrN5O4 and a molecular weight of 532.35 g/mol. Its IUPAC name is N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(2-oxo-1H-quinolin-3-yl)methylideneamino]oxamide.
| Compound Name | N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(2-oxo-1H-quinolin-3-yl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 4595859 |
| Molecular Formula | C25H18BrN5O4 |
| Molecular Weight | 532.35 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(2-oxo-1H-quinolin-3-yl)methylideneamino]oxamide |
| SMILES | O=C(NN=Cc1cc2ccccc2[nH]c1=O)C(=O)Nc1ccccc1C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C25H18BrN5O4/c26-17-9-11-18(12-10-17)28-23(33)19-6-2-4-8-21(19)30-24(34)25(35)31-27-14-16-13-15-5-1-3-7-20(15)29-22(16)32/h1-14H,(H,28,33)(H,29,32)(H,30,34)(H,31,35) |
| InChIKey | NYMAJSOGPZCEFU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|