C18H13ClN4O3 — CID 5103569
N-(4-chlorophenyl)-N'-[(2-oxo-1H-quinolin-3-yl)methylideneamino]oxamide (PubChem CID 5103569) has the molecular formula C18H13ClN4O3 and a molecular weight of 368.78 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N'-[(2-oxo-1H-quinolin-3-yl)methylideneamino]oxamide.
| Compound Name | N-(4-chlorophenyl)-N'-[(2-oxo-1H-quinolin-3-yl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 5103569 |
| Molecular Formula | C18H13ClN4O3 |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N-(4-chlorophenyl)-N'-[(2-oxo-1H-quinolin-3-yl)methylideneamino]oxamide |
| SMILES | O=C(NN=Cc1cc2ccccc2[nH]c1=O)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13ClN4O3/c19-13-5-7-14(8-6-13)21-17(25)18(26)23-20-10-12-9-11-3-1-2-4-15(11)22-16(12)24/h1-10H,(H,21,25)(H,22,24)(H,23,26) |
| InChIKey | VOICOALWNIWQIR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|