C19H16ClN3O3 — CID 135752432
2-(4-chlorophenoxy)-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]propanamide (PubChem CID 135752432) has the molecular formula C19H16ClN3O3 and a molecular weight of 369.81 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]propanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 135752432 |
| Molecular Formula | C19H16ClN3O3 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1)C(=O)N/N=C/c1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C19H16ClN3O3/c1-12(26-16-8-6-15(20)7-9-16)18(24)23-21-11-14-10-13-4-2-3-5-17(13)22-19(14)25/h2-12H,1H3,(H,22,25)(H,23,24)/b21-11+ |
| InChIKey | JJJMHBOCJZHXBS-SRZZPIQSSA-N |
| XLogP | 3.10 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|