C19H15Cl2N3O3 — CID 135615241
2-(2,4-dichlorophenoxy)-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]propanamide (PubChem CID 135615241) has the molecular formula C19H15Cl2N3O3 and a molecular weight of 404.25 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 135615241 |
| Molecular Formula | C19H15Cl2N3O3 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(E)-(2-oxo-1H-quinolin-3-yl)methylideneamino]propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)N/N=C/c1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C19H15Cl2N3O3/c1-11(27-17-7-6-14(20)9-15(17)21)18(25)24-22-10-13-8-12-4-2-3-5-16(12)23-19(13)26/h2-11H,1H3,(H,23,26)(H,24,25)/b22-10+ |
| InChIKey | DYXCQCJCJQYBHB-LSHDLFTRSA-N |
| XLogP | 3.75 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|