C17H15Cl3N2O2 — CID 7036505
(2R)-2-(4-chloro-2-methylphenoxy)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]propanamide (PubChem CID 7036505) has the molecular formula C17H15Cl3N2O2 and a molecular weight of 385.68 g/mol. Its IUPAC name is (2R)-2-(4-chloro-2-methylphenoxy)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]propanamide.
| Compound Name | (2R)-2-(4-chloro-2-methylphenoxy)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 7036505 |
| Molecular Formula | C17H15Cl3N2O2 |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | (2R)-2-(4-chloro-2-methylphenoxy)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]propanamide |
| SMILES | Cc1cc(Cl)ccc1O[C@H](C)C(=O)N/N=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H15Cl3N2O2/c1-10-7-13(18)5-6-16(10)24-11(2)17(23)22-21-9-12-3-4-14(19)8-15(12)20/h3-9,11H,1-2H3,(H,22,23)/b21-9-/t11-/m1/s1 |
| InChIKey | VEVBMBLLPWVRAJ-LBUZSKGWSA-N |
| XLogP | 4.87 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|