C16H18Cl2N4O2 — CID 5433457
(2R)-2-(2,4-dichlorophenoxy)-N-[(Z)-(1-ethyl-3-methylpyrazol-4-yl)methylideneamino]propanamide (PubChem CID 5433457) has the molecular formula C16H18Cl2N4O2 and a molecular weight of 369.25 g/mol. Its IUPAC name is (2R)-2-(2,4-dichlorophenoxy)-N-[(Z)-(1-ethyl-3-methylpyrazol-4-yl)methylideneamino]propanamide.
| Compound Name | (2R)-2-(2,4-dichlorophenoxy)-N-[(Z)-(1-ethyl-3-methylpyrazol-4-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 5433457 |
| Molecular Formula | C16H18Cl2N4O2 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | (2R)-2-(2,4-dichlorophenoxy)-N-[(Z)-(1-ethyl-3-methylpyrazol-4-yl)methylideneamino]propanamide |
| SMILES | CCn1cc(/C=N\NC(=O)[C@@H](C)Oc2ccc(Cl)cc2Cl)c(C)n1 |
| InChI | InChI=1S/C16H18Cl2N4O2/c1-4-22-9-12(10(2)21-22)8-19-20-16(23)11(3)24-15-6-5-13(17)7-14(15)18/h5-9,11H,4H2,1-3H3,(H,20,23)/b19-8-/t11-/m1/s1 |
| InChIKey | UZHISFQPXITQQR-DLGFXHSSSA-N |
| XLogP | 3.44 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|