C19H19Cl2N3O5 — CID 5097247
N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 5097247) has the molecular formula C19H19Cl2N3O5 and a molecular weight of 440.28 g/mol. Its IUPAC name is N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 5097247 |
| Molecular Formula | C19H19Cl2N3O5 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | COc1cc(C=NNC(=O)C(C)Oc2ccc(Cl)cc2Cl)ccc1OCC(N)=O |
| InChI | InChI=1S/C19H19Cl2N3O5/c1-11(29-15-6-4-13(20)8-14(15)21)19(26)24-23-9-12-3-5-16(17(7-12)27-2)28-10-18(22)25/h3-9,11H,10H2,1-2H3,(H2,22,25)(H,24,26) |
| InChIKey | SURDYWHMOWVXBX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|