C22H25ClN4O5 — CID 3498479
N-[1-[2-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide (PubChem CID 3498479) has the molecular formula C22H25ClN4O5 and a molecular weight of 460.92 g/mol. Its IUPAC name is N-[1-[2-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide.
| Compound Name | N-[1-[2-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 3498479 |
| Molecular Formula | C22H25ClN4O5 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | N-[1-[2-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
| SMILES | COc1cc(C=NNC(=O)C(NC(=O)c2ccc(Cl)cc2)C(C)C)ccc1OCC(N)=O |
| InChI | InChI=1S/C22H25ClN4O5/c1-13(2)20(26-21(29)15-5-7-16(23)8-6-15)22(30)27-25-11-14-4-9-17(18(10-14)31-3)32-12-19(24)28/h4-11,13,20H,12H2,1-3H3,(H2,24,28)(H,26,29)(H,27,30) |
| InChIKey | DAYXACYBGYYOTP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|