C20H21BrClN3O3 — CID 6179235
N-[1-[(2Z)-2-[(3-bromo-4-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide (PubChem CID 6179235) has the molecular formula C20H21BrClN3O3 and a molecular weight of 466.76 g/mol. Its IUPAC name is N-[1-[(2Z)-2-[(3-bromo-4-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide.
| Compound Name | N-[1-[(2Z)-2-[(3-bromo-4-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 6179235 |
| Molecular Formula | C20H21BrClN3O3 |
| Molecular Weight | 466.76 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | N-[1-[(2Z)-2-[(3-bromo-4-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
| SMILES | COc1ccc(/C=N\NC(=O)C(NC(=O)c2ccc(Cl)cc2)C(C)C)cc1Br |
| InChI | InChI=1S/C20H21BrClN3O3/c1-12(2)18(24-19(26)14-5-7-15(22)8-6-14)20(27)25-23-11-13-4-9-17(28-3)16(21)10-13/h4-12,18H,1-3H3,(H,24,26)(H,25,27)/b23-11- |
| InChIKey | GNGXIHSOPOZVNN-KSEXSDGBSA-N |
| XLogP | 4.02 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.76 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|