C20H21BrClN3O4 — CID 135590325
N-[1-[(2E)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide (PubChem CID 135590325) has the molecular formula C20H21BrClN3O4 and a molecular weight of 482.76 g/mol. Its IUPAC name is N-[1-[(2E)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide.
| Compound Name | N-[1-[(2E)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 135590325 |
| Molecular Formula | C20H21BrClN3O4 |
| Molecular Weight | 482.76 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | N-[1-[(2E)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
| SMILES | COc1cc(Br)cc(/C=N/NC(=O)C(NC(=O)c2ccc(Cl)cc2)C(C)C)c1O |
| InChI | InChI=1S/C20H21BrClN3O4/c1-11(2)17(24-19(27)12-4-6-15(22)7-5-12)20(28)25-23-10-13-8-14(21)9-16(29-3)18(13)26/h4-11,17,26H,1-3H3,(H,24,27)(H,25,28)/b23-10+ |
| InChIKey | UKSWQSCUUKQZDF-AUEPDCJTSA-N |
| XLogP | 3.72 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.76 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|