C21H22BrCl2N3O4 — CID 6108312
N-[1-[(2Z)-2-[(5-bromo-2,4-dimethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide (PubChem CID 6108312) has the molecular formula C21H22BrCl2N3O4 and a molecular weight of 531.23 g/mol. Its IUPAC name is N-[1-[(2Z)-2-[(5-bromo-2,4-dimethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide.
| Compound Name | N-[1-[(2Z)-2-[(5-bromo-2,4-dimethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 6108312 |
| Molecular Formula | C21H22BrCl2N3O4 |
| Molecular Weight | 531.23 g/mol |
| Exact Mass | 529.02 |
| IUPAC Name | N-[1-[(2Z)-2-[(5-bromo-2,4-dimethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide |
| SMILES | COc1cc(OC)c(/C=N\NC(=O)C(NC(=O)c2ccc(Cl)c(Cl)c2)C(C)C)cc1Br |
| InChI | InChI=1S/C21H22BrCl2N3O4/c1-11(2)19(26-20(28)12-5-6-15(23)16(24)8-12)21(29)27-25-10-13-7-14(22)18(31-4)9-17(13)30-3/h5-11,19H,1-4H3,(H,26,28)(H,27,29)/b25-10- |
| InChIKey | YZCVYWAPNFMSBV-MRUKODCESA-N |
| XLogP | 4.68 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.23 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|