C27H25BrCl3N3O4 — CID 4017793
N-[1-[2-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide (PubChem CID 4017793) has the molecular formula C27H25BrCl3N3O4 and a molecular weight of 641.78 g/mol. Its IUPAC name is N-[1-[2-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide.
| Compound Name | N-[1-[2-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 4017793 |
| Molecular Formula | C27H25BrCl3N3O4 |
| Molecular Weight | 641.78 g/mol |
| Exact Mass | 639.01 |
| IUPAC Name | N-[1-[2-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide |
| SMILES | COc1cc(C=NNC(=O)C(NC(=O)c2ccc(Cl)c(Cl)c2)C(C)C)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C27H25BrCl3N3O4/c1-15(2)24(33-26(35)17-8-9-21(30)22(31)12-17)27(36)34-32-13-16-10-19(28)25(23(11-16)37-3)38-14-18-6-4-5-7-20(18)29/h4-13,15,24H,14H2,1-3H3,(H,33,35)(H,34,36) |
| InChIKey | NXXVMSPSISNPCM-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.78 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|