C27H28BrN3O4 — CID 3657472
N-[1-[2-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 3657472) has the molecular formula C27H28BrN3O4 and a molecular weight of 538.44 g/mol. Its IUPAC name is N-[1-[2-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | N-[1-[2-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 3657472 |
| Molecular Formula | C27H28BrN3O4 |
| Molecular Weight | 538.44 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | N-[1-[2-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | COc1cc(C=NNC(=O)C(NC(=O)c2ccccc2)C(C)C)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H28BrN3O4/c1-18(2)24(30-26(32)21-12-8-5-9-13-21)27(33)31-29-16-20-14-22(28)25(23(15-20)34-3)35-17-19-10-6-4-7-11-19/h4-16,18,24H,17H2,1-3H3,(H,30,32)(H,31,33) |
| InChIKey | FKYXXTOKSGDJOK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|