C21H24IN3O4 — CID 4002249
N-[1-[2-[(3-iodo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 4002249) has the molecular formula C21H24IN3O4 and a molecular weight of 509.34 g/mol. Its IUPAC name is N-[1-[2-[(3-iodo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | N-[1-[2-[(3-iodo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 4002249 |
| Molecular Formula | C21H24IN3O4 |
| Molecular Weight | 509.34 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | N-[1-[2-[(3-iodo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | COc1cc(C=NNC(=O)C(NC(=O)c2ccccc2)C(C)C)cc(I)c1OC |
| InChI | InChI=1S/C21H24IN3O4/c1-13(2)18(24-20(26)15-8-6-5-7-9-15)21(27)25-23-12-14-10-16(22)19(29-4)17(11-14)28-3/h5-13,18H,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | HTSPAPGWYFPREP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|