C25H32IN3O4 — CID 3940379
N-[1-[2-[(3-ethoxy-5-iodo-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-methylbenzamide (PubChem CID 3940379) has the molecular formula C25H32IN3O4 and a molecular weight of 565.45 g/mol. Its IUPAC name is N-[1-[2-[(3-ethoxy-5-iodo-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-methylbenzamide.
| Compound Name | N-[1-[2-[(3-ethoxy-5-iodo-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 3940379 |
| Molecular Formula | C25H32IN3O4 |
| Molecular Weight | 565.45 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | N-[1-[2-[(3-ethoxy-5-iodo-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-methylbenzamide |
| SMILES | CCOc1cc(C=NNC(=O)C(NC(=O)c2ccc(C)cc2)C(C)C)cc(I)c1OC(C)C |
| InChI | InChI=1S/C25H32IN3O4/c1-7-32-21-13-18(12-20(26)23(21)33-16(4)5)14-27-29-25(31)22(15(2)3)28-24(30)19-10-8-17(6)9-11-19/h8-16,22H,7H2,1-6H3,(H,28,30)(H,29,31) |
| InChIKey | WVIUHHFRSGJVOU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|