C25H31BrClN3O4 — CID 6079929
N-[1-[(2Z)-2-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide (PubChem CID 6079929) has the molecular formula C25H31BrClN3O4 and a molecular weight of 552.90 g/mol. Its IUPAC name is N-[1-[(2Z)-2-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide.
| Compound Name | N-[1-[(2Z)-2-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 6079929 |
| Molecular Formula | C25H31BrClN3O4 |
| Molecular Weight | 552.90 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | N-[1-[(2Z)-2-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
| SMILES | CCCCOc1c(Br)cc(/C=N\NC(=O)C(NC(=O)c2ccc(Cl)cc2)C(C)C)cc1OCC |
| InChI | InChI=1S/C25H31BrClN3O4/c1-5-7-12-34-23-20(26)13-17(14-21(23)33-6-2)15-28-30-25(32)22(16(3)4)29-24(31)18-8-10-19(27)11-9-18/h8-11,13-16,22H,5-7,12H2,1-4H3,(H,29,31)(H,30,32)/b28-15- |
| InChIKey | SOAIPVYXWUJMPG-MBTHVWNTSA-N |
| XLogP | 5.58 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.90 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|