C23H25BrCl2N4O5 — CID 3878357
N-[1-[2-[[4-(2-amino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide (PubChem CID 3878357) has the molecular formula C23H25BrCl2N4O5 and a molecular weight of 588.29 g/mol. Its IUPAC name is N-[1-[2-[[4-(2-amino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[1-[2-[[4-(2-amino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 3878357 |
| Molecular Formula | C23H25BrCl2N4O5 |
| Molecular Weight | 588.29 g/mol |
| Exact Mass | 586.04 |
| IUPAC Name | N-[1-[2-[[4-(2-amino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide |
| SMILES | CCOc1cc(C=NNC(=O)C(NC(=O)c2ccc(Cl)cc2Cl)C(C)C)cc(Br)c1OCC(N)=O |
| InChI | InChI=1S/C23H25BrCl2N4O5/c1-4-34-18-8-13(7-16(24)21(18)35-11-19(27)31)10-28-30-23(33)20(12(2)3)29-22(32)15-6-5-14(25)9-17(15)26/h5-10,12,20H,4,11H2,1-3H3,(H2,27,31)(H,29,32)(H,30,33) |
| InChIKey | NSHJDROMFWQDSR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|