C24H29BrClN3O4 — CID 6148232
N-[1-[(2Z)-2-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide (PubChem CID 6148232) has the molecular formula C24H29BrClN3O4 and a molecular weight of 538.87 g/mol. Its IUPAC name is N-[1-[(2Z)-2-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide.
| Compound Name | N-[1-[(2Z)-2-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 6148232 |
| Molecular Formula | C24H29BrClN3O4 |
| Molecular Weight | 538.87 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | N-[1-[(2Z)-2-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide |
| SMILES | CCCOc1c(Br)cc(/C=N\NC(=O)C(NC(=O)c2ccccc2Cl)C(C)C)cc1OCC |
| InChI | InChI=1S/C24H29BrClN3O4/c1-5-11-33-22-18(25)12-16(13-20(22)32-6-2)14-27-29-24(31)21(15(3)4)28-23(30)17-9-7-8-10-19(17)26/h7-10,12-15,21H,5-6,11H2,1-4H3,(H,28,30)(H,29,31)/b27-14- |
| InChIKey | GDWIFDRZIWSMOC-VYYCAZPPSA-N |
| XLogP | 5.19 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.87 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|