C21H22BrCl2N3O4 — CID 135715707
N-[1-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide (PubChem CID 135715707) has the molecular formula C21H22BrCl2N3O4 and a molecular weight of 531.23 g/mol. Its IUPAC name is N-[1-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[1-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 135715707 |
| Molecular Formula | C21H22BrCl2N3O4 |
| Molecular Weight | 531.23 g/mol |
| Exact Mass | 529.02 |
| IUPAC Name | N-[1-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)C(NC(=O)c2ccc(Cl)cc2Cl)C(C)C)cc(Br)c1O |
| InChI | InChI=1S/C21H22BrCl2N3O4/c1-4-31-17-8-12(7-15(22)19(17)28)10-25-27-21(30)18(11(2)3)26-20(29)14-6-5-13(23)9-16(14)24/h5-11,18,28H,4H2,1-3H3,(H,26,29)(H,27,30)/b25-10+ |
| InChIKey | SEOAHNKSHZRAHC-KIBLKLHPSA-N |
| XLogP | 4.76 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.23 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|