C24H27BrClN3O6 — CID 5163046
methyl 2-[2-bromo-4-[[[2-[(4-chlorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate (PubChem CID 5163046) has the molecular formula C24H27BrClN3O6 and a molecular weight of 568.85 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[[[2-[(4-chlorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[[[2-[(4-chlorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 5163046 |
| Molecular Formula | C24H27BrClN3O6 |
| Molecular Weight | 568.85 g/mol |
| Exact Mass | 567.08 |
| IUPAC Name | methyl 2-[2-bromo-4-[[[2-[(4-chlorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(C=NNC(=O)C(NC(=O)c2ccc(Cl)cc2)C(C)C)cc(Br)c1OCC(=O)OC |
| InChI | InChI=1S/C24H27BrClN3O6/c1-5-34-19-11-15(10-18(25)22(19)35-13-20(30)33-4)12-27-29-24(32)21(14(2)3)28-23(31)16-6-8-17(26)9-7-16/h6-12,14,21H,5,13H2,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | JCZRACKULIUNGS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.85 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|