C22H25BrFN3O4 — CID 3562687
N-[1-[2-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide (PubChem CID 3562687) has the molecular formula C22H25BrFN3O4 and a molecular weight of 494.36 g/mol. Its IUPAC name is N-[1-[2-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide.
| Compound Name | N-[1-[2-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 3562687 |
| Molecular Formula | C22H25BrFN3O4 |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | N-[1-[2-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide |
| SMILES | CCOc1cc(C=NNC(=O)C(NC(=O)c2ccc(F)cc2)C(C)C)cc(Br)c1OC |
| InChI | InChI=1S/C22H25BrFN3O4/c1-5-31-18-11-14(10-17(23)20(18)30-4)12-25-27-22(29)19(13(2)3)26-21(28)15-6-8-16(24)9-7-15/h6-13,19H,5H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | BLCVCEIHLPPEFF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|