C24H29BrFN3O4 — CID 5160557
N-[1-[2-[(3-bromo-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide (PubChem CID 5160557) has the molecular formula C24H29BrFN3O4 and a molecular weight of 522.42 g/mol. Its IUPAC name is N-[1-[2-[(3-bromo-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide.
| Compound Name | N-[1-[2-[(3-bromo-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 5160557 |
| Molecular Formula | C24H29BrFN3O4 |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | N-[1-[2-[(3-bromo-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
| SMILES | CCOc1cc(C=NNC(=O)C(NC(=O)c2ccccc2F)C(C)C)cc(Br)c1OC(C)C |
| InChI | InChI=1S/C24H29BrFN3O4/c1-6-32-20-12-16(11-18(25)22(20)33-15(4)5)13-27-29-24(31)21(14(2)3)28-23(30)17-9-7-8-10-19(17)26/h7-15,21H,6H2,1-5H3,(H,28,30)(H,29,31) |
| InChIKey | HKMVXVZHOQEAOC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|