C24H28FN3O6 — CID 3935206
methyl 2-[2-ethoxy-4-[[[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 3935206) has the molecular formula C24H28FN3O6 and a molecular weight of 473.50 g/mol. Its IUPAC name is methyl 2-[2-ethoxy-4-[[[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-ethoxy-4-[[[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3935206 |
| Molecular Formula | C24H28FN3O6 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | methyl 2-[2-ethoxy-4-[[[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOc1cc(C=NNC(=O)C(NC(=O)c2ccc(F)cc2)C(C)C)ccc1OCC(=O)OC |
| InChI | InChI=1S/C24H28FN3O6/c1-5-33-20-12-16(6-11-19(20)34-14-21(29)32-4)13-26-28-24(31)22(15(2)3)27-23(30)17-7-9-18(25)10-8-17/h6-13,15,22H,5,14H2,1-4H3,(H,27,30)(H,28,31) |
| InChIKey | SKGBOOZYMGUIFN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|