C22H24FN3O5 — CID 3339752
methyl 2-[4-[[[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 3339752) has the molecular formula C22H24FN3O5 and a molecular weight of 429.45 g/mol. Its IUPAC name is methyl 2-[4-[[[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[[[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3339752 |
| Molecular Formula | C22H24FN3O5 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | methyl 2-[4-[[[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C=NNC(=O)C(NC(=O)c2ccc(F)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C22H24FN3O5/c1-14(2)20(25-21(28)16-6-8-17(23)9-7-16)22(29)26-24-12-15-4-10-18(11-5-15)31-13-19(27)30-3/h4-12,14,20H,13H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | CKXHIHQKXMSYRB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|