C24H29N3O6 — CID 4013645
methyl 2-[2-methoxy-4-[[[3-methyl-2-[(4-methylbenzoyl)amino]butanoyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 4013645) has the molecular formula C24H29N3O6 and a molecular weight of 455.51 g/mol. Its IUPAC name is methyl 2-[2-methoxy-4-[[[3-methyl-2-[(4-methylbenzoyl)amino]butanoyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-methoxy-4-[[[3-methyl-2-[(4-methylbenzoyl)amino]butanoyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 4013645 |
| Molecular Formula | C24H29N3O6 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | methyl 2-[2-methoxy-4-[[[3-methyl-2-[(4-methylbenzoyl)amino]butanoyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C=NNC(=O)C(NC(=O)c2ccc(C)cc2)C(C)C)cc1OC |
| InChI | InChI=1S/C24H29N3O6/c1-15(2)22(26-23(29)18-9-6-16(3)7-10-18)24(30)27-25-13-17-8-11-19(20(12-17)31-4)33-14-21(28)32-5/h6-13,15,22H,14H2,1-5H3,(H,26,29)(H,27,30) |
| InChIKey | KBBXMBHJSMFVFH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|