C28H29BrClN3O4 — CID 3977241
N-[1-[2-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide (PubChem CID 3977241) has the molecular formula C28H29BrClN3O4 and a molecular weight of 586.91 g/mol. Its IUPAC name is N-[1-[2-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide.
| Compound Name | N-[1-[2-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 3977241 |
| Molecular Formula | C28H29BrClN3O4 |
| Molecular Weight | 586.91 g/mol |
| Exact Mass | 585.10 |
| IUPAC Name | N-[1-[2-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide |
| SMILES | COc1cc(C=NNC(=O)C(NC(=O)c2ccccc2Cl)C(C)C)cc(Br)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C28H29BrClN3O4/c1-17(2)25(32-27(34)21-7-5-6-8-23(21)30)28(35)33-31-15-20-13-22(29)26(24(14-20)36-4)37-16-19-11-9-18(3)10-12-19/h5-15,17,25H,16H2,1-4H3,(H,32,34)(H,33,35) |
| InChIKey | WSVCHTKTTIWPPS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.91 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|