C22H23ClIN3O6 — CID 5020773
2-[4-[[[2-[(3-chlorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetic acid (PubChem CID 5020773) has the molecular formula C22H23ClIN3O6 and a molecular weight of 587.80 g/mol. Its IUPAC name is 2-[4-[[[2-[(3-chlorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[[[2-[(3-chlorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 5020773 |
| Molecular Formula | C22H23ClIN3O6 |
| Molecular Weight | 587.80 g/mol |
| Exact Mass | 587.03 |
| IUPAC Name | 2-[4-[[[2-[(3-chlorobenzoyl)amino]-3-methylbutanoyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(C=NNC(=O)C(NC(=O)c2cccc(Cl)c2)C(C)C)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C22H23ClIN3O6/c1-12(2)19(26-21(30)14-5-4-6-15(23)9-14)22(31)27-25-10-13-7-16(24)20(17(8-13)32-3)33-11-18(28)29/h4-10,12,19H,11H2,1-3H3,(H,26,30)(H,27,31)(H,28,29) |
| InChIKey | ZDUVPAYZWSSRQN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.80 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|