C21H22Cl2N2O6 — CID 3302228
ethyl 2-[4-[[2-(2,4-dichlorophenoxy)propanoylhydrazinylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 3302228) has the molecular formula C21H22Cl2N2O6 and a molecular weight of 469.32 g/mol. Its IUPAC name is ethyl 2-[4-[[2-(2,4-dichlorophenoxy)propanoylhydrazinylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[[2-(2,4-dichlorophenoxy)propanoylhydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 3302228 |
| Molecular Formula | C21H22Cl2N2O6 |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | ethyl 2-[4-[[2-(2,4-dichlorophenoxy)propanoylhydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=NNC(=O)C(C)Oc2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C21H22Cl2N2O6/c1-4-29-20(26)12-30-18-7-5-14(9-19(18)28-3)11-24-25-21(27)13(2)31-17-8-6-15(22)10-16(17)23/h5-11,13H,4,12H2,1-3H3,(H,25,27) |
| InChIKey | AOWRPDOBGMUYMU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|