C19H20Cl2N2O5 — CID 41009806
(2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]propanamide (PubChem CID 41009806) has the molecular formula C19H20Cl2N2O5 and a molecular weight of 427.28 g/mol. Its IUPAC name is (2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]propanamide.
| Compound Name | (2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 41009806 |
| Molecular Formula | C19H20Cl2N2O5 |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | (2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]propanamide |
| SMILES | COc1cc(/C=N\NC(=O)[C@H](C)Oc2ccc(Cl)cc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C19H20Cl2N2O5/c1-11(28-15-6-5-13(20)9-14(15)21)19(24)23-22-10-12-7-16(25-2)18(27-4)17(8-12)26-3/h5-11H,1-4H3,(H,23,24)/b22-10-/t11-/m0/s1 |
| InChIKey | MTNICINLESPNPD-NQWZYWRBSA-N |
| XLogP | 3.94 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|