C17H15Cl2N3O6 — CID 5003322
2-(2,4-dichlorophenoxy)-N-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]propanamide (PubChem CID 5003322) has the molecular formula C17H15Cl2N3O6 and a molecular weight of 428.23 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 5003322 |
| Molecular Formula | C17H15Cl2N3O6 |
| Molecular Weight | 428.23 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]propanamide |
| SMILES | COc1cc(C=NNC(=O)C(C)Oc2ccc(Cl)cc2Cl)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C17H15Cl2N3O6/c1-9(28-14-4-3-11(18)7-12(14)19)17(24)21-20-8-10-5-13(22(25)26)16(23)15(6-10)27-2/h3-9,23H,1-2H3,(H,21,24) |
| InChIKey | YALDTOIQTNGTJP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|