C24H21Cl2N3O6 — CID 25301252
(2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]propanamide (PubChem CID 25301252) has the molecular formula C24H21Cl2N3O6 and a molecular weight of 518.35 g/mol. Its IUPAC name is (2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]propanamide.
| Compound Name | (2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 25301252 |
| Molecular Formula | C24H21Cl2N3O6 |
| Molecular Weight | 518.35 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | (2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]propanamide |
| SMILES | COc1cc(/C=N\NC(=O)[C@H](C)Oc2ccc(Cl)cc2Cl)c([N+](=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C24H21Cl2N3O6/c1-15(35-21-9-8-18(25)11-19(21)26)24(30)28-27-13-17-10-22(33-2)23(12-20(17)29(31)32)34-14-16-6-4-3-5-7-16/h3-13,15H,14H2,1-2H3,(H,28,30)/b27-13-/t15-/m0/s1 |
| InChIKey | VCZSAZMDBMZBME-CKTUNODQSA-N |
| XLogP | 5.41 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.35 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|